C8H10N2O5 — CID 103973426
3-methoxy-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid (PubChem CID 103973426) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 3-methoxy-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid.
| Compound Name | 3-methoxy-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 103973426 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-methoxy-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-3-oxopropanoic acid |
| SMILES | COC(=O)C(Cc1nonc1C)C(=O)O |
| InChI | InChI=1S/C8H10N2O5/c1-4-6(10-15-9-4)3-5(7(11)12)8(13)14-2/h5H,3H2,1-2H3,(H,11,12) |
| InChIKey | PHZWMMXLKZNSPS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|