C13H22O7S — CID 103973455
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-hydroxyhexanoic acid (PubChem CID 103973455) has the molecular formula C13H22O7S and a molecular weight of 322.38 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-hydroxyhexanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 103973455 |
| Molecular Formula | C13H22O7S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-hydroxyhexanoic acid |
| SMILES | CCOC(=O)C(CC(O)CC)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22O7S/c1-3-10(14)7-13(11(15)16,12(17)20-4-2)9-5-6-21(18,19)8-9/h9-10,14H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | GRONXJJZAVPIAP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|