C8H13N5 — CID 10397373
3-N,3-N-bis(prop-2-enyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 10397373) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 3-N,3-N-bis(prop-2-enyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N,3-N-bis(prop-2-enyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 10397373 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 3-N,3-N-bis(prop-2-enyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | C=CCN(CC=C)c1n[nH]c(N)n1 |
| InChI | InChI=1S/C8H13N5/c1-3-5-13(6-4-2)8-10-7(9)11-12-8/h3-4H,1-2,5-6H2,(H3,9,10,11,12) |
| InChIKey | WDIJMXNLSBXDEW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|