About 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid
3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid (PubChem CID 103973917) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid |
| PubChem CID | 103973917 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(C)(Cc1ncnn1CC)C(=O)O |
| InChI | InChI=1S/C11H17N3O4/c1-4-14-8(12-7-13-14)6-11(3,9(15)16)10(17)18-5-2/h7H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | GIMDEUPXWFNDTD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid?
The IUPAC name of 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid (CID 103973917) is 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid.
What is the SMILES notation for 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid?
The canonical SMILES for 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid is CCOC(=O)C(C)(Cc1ncnn1CC)C(=O)O.
What is the InChIKey of 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid?
The InChIKey is GIMDEUPXWFNDTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4/c1-4-14-8(12-7-13-14)6-11(3,9(15)16)10(17)18-5-2/h7H,4-6H2,1-3H3,(H,15,16).
What are the key properties of 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid?
3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid has a molecular weight of 255.27 g/mol, XLogP of 0.49, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-oxopropanoic acid is sourced from PubChem (CID 103973917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).