About 6-methoxy-1,2-benzothiazol-3-amine
6-methoxy-1,2-benzothiazol-3-amine (PubChem CID 10397392) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 6-methoxy-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | 6-methoxy-1,2-benzothiazol-3-amine |
| PubChem CID | 10397392 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 6-methoxy-1,2-benzothiazol-3-amine |
| SMILES | COc1ccc2c(N)nsc2c1 |
| InChI | InChI=1S/C8H8N2OS/c1-11-5-2-3-6-7(4-5)12-10-8(6)9/h2-4H,1H3,(H2,9,10) |
| InChIKey | QBRIJTLELFDTIN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1,2-benzothiazol-3-amine?
The IUPAC name of 6-methoxy-1,2-benzothiazol-3-amine (CID 10397392) is 6-methoxy-1,2-benzothiazol-3-amine.
What is the SMILES notation for 6-methoxy-1,2-benzothiazol-3-amine?
The canonical SMILES for 6-methoxy-1,2-benzothiazol-3-amine is COc1ccc2c(N)nsc2c1.
What is the InChIKey of 6-methoxy-1,2-benzothiazol-3-amine?
The InChIKey is QBRIJTLELFDTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c1-11-5-2-3-6-7(4-5)12-10-8(6)9/h2-4H,1H3,(H2,9,10).
What are the key properties of 6-methoxy-1,2-benzothiazol-3-amine?
6-methoxy-1,2-benzothiazol-3-amine has a molecular weight of 180.23 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1,2-benzothiazol-3-amine is sourced from PubChem (CID 10397392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).