C14H23N3O4 — CID 103974051
2-ethoxycarbonyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-methylpentanoic acid (PubChem CID 103974051) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-methylpentanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103974051 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-ethoxycarbonyl-2-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-4-methylpentanoic acid |
| SMILES | CCOC(=O)C(Cc1ncnn1CC)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H23N3O4/c1-5-17-11(15-9-16-17)8-14(12(18)19,7-10(3)4)13(20)21-6-2/h9-10H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | XTQFAZUUOVBPAU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|