About buta-1,3-diynyl-dimethyl-trimethylsilylsilane
buta-1,3-diynyl-dimethyl-trimethylsilylsilane (PubChem CID 10397409) has the molecular formula C9H16Si2
and a molecular weight of 180.40 g/mol. Its IUPAC name is buta-1,3-diynyl-dimethyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | buta-1,3-diynyl-dimethyl-trimethylsilylsilane |
| PubChem CID | 10397409 |
| Molecular Formula | C9H16Si2 |
| Molecular Weight | 180.40 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | buta-1,3-diynyl-dimethyl-trimethylsilylsilane |
| SMILES | C#CC#C[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C9H16Si2/c1-7-8-9-11(5,6)10(2,3)4/h1H,2-6H3 |
| InChIKey | WMPSXFZPQBXOQK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diynyl-dimethyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diynyl-dimethyl-trimethylsilylsilane?
The IUPAC name of buta-1,3-diynyl-dimethyl-trimethylsilylsilane (CID 10397409) is buta-1,3-diynyl-dimethyl-trimethylsilylsilane.
What is the SMILES notation for buta-1,3-diynyl-dimethyl-trimethylsilylsilane?
The canonical SMILES for buta-1,3-diynyl-dimethyl-trimethylsilylsilane is C#CC#C[Si](C)(C)[Si](C)(C)C.
What is the InChIKey of buta-1,3-diynyl-dimethyl-trimethylsilylsilane?
The InChIKey is WMPSXFZPQBXOQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16Si2/c1-7-8-9-11(5,6)10(2,3)4/h1H,2-6H3.
What are the key properties of buta-1,3-diynyl-dimethyl-trimethylsilylsilane?
buta-1,3-diynyl-dimethyl-trimethylsilylsilane has a molecular weight of 180.40 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diynyl-dimethyl-trimethylsilylsilane is sourced from PubChem (CID 10397409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).