C15H22F2N2O2 — CID 103975538
1-[1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]pyrrolidin-3-yl]ethanamine (PubChem CID 103975538) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-[1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]pyrrolidin-3-yl]ethanamine.
| Compound Name | 1-[1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]pyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 103975538 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[1-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]pyrrolidin-3-yl]ethanamine |
| SMILES | COc1ccc(CN2CCC(C(C)N)C2)cc1OC(F)F |
| InChI | InChI=1S/C15H22F2N2O2/c1-10(18)12-5-6-19(9-12)8-11-3-4-13(20-2)14(7-11)21-15(16)17/h3-4,7,10,12,15H,5-6,8-9,18H2,1-2H3 |
| InChIKey | JPTFUBQWLCZOIZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |