About 1-trimethylsilylhexane-1,5-dione
1-trimethylsilylhexane-1,5-dione (PubChem CID 10397556) has the molecular formula C9H18O2Si
and a molecular weight of 186.33 g/mol. Its IUPAC name is 1-trimethylsilylhexane-1,5-dione.
Molecular Properties
| Compound Name | 1-trimethylsilylhexane-1,5-dione |
| PubChem CID | 10397556 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 1-trimethylsilylhexane-1,5-dione |
| SMILES | CC(=O)CCCC(=O)[Si](C)(C)C |
| InChI | InChI=1S/C9H18O2Si/c1-8(10)6-5-7-9(11)12(2,3)4/h5-7H2,1-4H3 |
| InChIKey | BDQOMUWMXQKCBF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-trimethylsilylhexane-1,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trimethylsilylhexane-1,5-dione?
The IUPAC name of 1-trimethylsilylhexane-1,5-dione (CID 10397556) is 1-trimethylsilylhexane-1,5-dione.
What is the SMILES notation for 1-trimethylsilylhexane-1,5-dione?
The canonical SMILES for 1-trimethylsilylhexane-1,5-dione is CC(=O)CCCC(=O)[Si](C)(C)C.
What is the InChIKey of 1-trimethylsilylhexane-1,5-dione?
The InChIKey is BDQOMUWMXQKCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2Si/c1-8(10)6-5-7-9(11)12(2,3)4/h5-7H2,1-4H3.
What are the key properties of 1-trimethylsilylhexane-1,5-dione?
1-trimethylsilylhexane-1,5-dione has a molecular weight of 186.33 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trimethylsilylhexane-1,5-dione is sourced from PubChem (CID 10397556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).