C13H18ClN3O2 — CID 103976475
1-[1-[(2-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]ethanamine (PubChem CID 103976475) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]ethanamine.
| Compound Name | 1-[1-[(2-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 103976475 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-[1-[(2-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]ethanamine |
| SMILES | CC(N)C1CCN(Cc2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-9(15)10-4-5-16(7-10)8-11-2-3-12(17(18)19)6-13(11)14/h2-3,6,9-10H,4-5,7-8,15H2,1H3 |
| InChIKey | AWTWRFCFWFDKIH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|