C21H20IN5 — CID 1039766
(8S,8aS)-6-amino-8-(3-iodophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 1039766) has the molecular formula C21H20IN5 and a molecular weight of 469.33 g/mol. Its IUPAC name is (8S,8aS)-6-amino-8-(3-iodophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aS)-6-amino-8-(3-iodophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 1039766 |
| Molecular Formula | C21H20IN5 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | (8S,8aS)-6-amino-8-(3-iodophenyl)-2-propyl-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | CCCN1CC=C2C(C#N)=C(N)C(C#N)(C#N)[C@H](c3cccc(I)c3)[C@@H]2C1 |
| InChI | InChI=1S/C21H20IN5/c1-2-7-27-8-6-16-17(10-23)20(26)21(12-24,13-25)19(18(16)11-27)14-4-3-5-15(22)9-14/h3-6,9,18-19H,2,7-8,11,26H2,1H3/t18-,19-/m1/s1 |
| InChIKey | LYFZBIWOFJRIPT-RTBURBONSA-N |
| XLogP | 3.43 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|