C11H18N4 — CID 103976639
1-[1-(3-methylpyrazin-2-yl)pyrrolidin-3-yl]ethanamine (PubChem CID 103976639) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-[1-(3-methylpyrazin-2-yl)pyrrolidin-3-yl]ethanamine.
| Compound Name | 1-[1-(3-methylpyrazin-2-yl)pyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 103976639 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-[1-(3-methylpyrazin-2-yl)pyrrolidin-3-yl]ethanamine |
| SMILES | Cc1nccnc1N1CCC(C(C)N)C1 |
| InChI | InChI=1S/C11H18N4/c1-8(12)10-3-6-15(7-10)11-9(2)13-4-5-14-11/h4-5,8,10H,3,6-7,12H2,1-2H3 |
| InChIKey | BQOVFHJWDPTUGO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |