C7H4ClN3O2 — CID 10397814
6-chloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 10397814) has the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. Its IUPAC name is 6-chloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6-chloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 10397814 |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.58 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 6-chloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2ccc(Cl)nc2[nH]c1=O |
| InChI | InChI=1S/C7H4ClN3O2/c8-4-2-1-3-5(10-4)11-7(13)6(12)9-3/h1-2H,(H,9,12)(H,10,11,13) |
| InChIKey | QPRGYGULZXMPFU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.58 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|