C14H23NO6 — CID 103978387
2-[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 103978387) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103978387 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[(2-ethoxy-2-oxoethyl)-(2-methoxyethyl)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CCOC(=O)CN(CCOC)C(=O)C1CCCC1C(=O)O |
| InChI | InChI=1S/C14H23NO6/c1-3-21-12(16)9-15(7-8-20-2)13(17)10-5-4-6-11(10)14(18)19/h10-11H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | SOFJKRBIWORDQY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |