About 3-N-benzylpyridine-2,3-diamine
3-N-benzylpyridine-2,3-diamine (PubChem CID 10397869) has the molecular formula C12H13N3
and a molecular weight of 199.26 g/mol. Its IUPAC name is 3-N-benzylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-benzylpyridine-2,3-diamine |
| PubChem CID | 10397869 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-N-benzylpyridine-2,3-diamine |
| SMILES | Nc1ncccc1NCc1ccccc1 |
| InChI | InChI=1S/C12H13N3/c13-12-11(7-4-8-14-12)15-9-10-5-2-1-3-6-10/h1-8,15H,9H2,(H2,13,14) |
| InChIKey | MUKAGFLFIMVSQN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-benzylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-benzylpyridine-2,3-diamine?
The IUPAC name of 3-N-benzylpyridine-2,3-diamine (CID 10397869) is 3-N-benzylpyridine-2,3-diamine.
What is the SMILES notation for 3-N-benzylpyridine-2,3-diamine?
The canonical SMILES for 3-N-benzylpyridine-2,3-diamine is Nc1ncccc1NCc1ccccc1.
What is the InChIKey of 3-N-benzylpyridine-2,3-diamine?
The InChIKey is MUKAGFLFIMVSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3/c13-12-11(7-4-8-14-12)15-9-10-5-2-1-3-6-10/h1-8,15H,9H2,(H2,13,14).
What are the key properties of 3-N-benzylpyridine-2,3-diamine?
3-N-benzylpyridine-2,3-diamine has a molecular weight of 199.26 g/mol, XLogP of 2.28, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-benzylpyridine-2,3-diamine is sourced from PubChem (CID 10397869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).