C14H12FNO4 — CID 103979266
3-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-4-fluorobenzoic acid (PubChem CID 103979266) has the molecular formula C14H12FNO4 and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-4-fluorobenzoic acid.
| Compound Name | 3-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 103979266 |
| Molecular Formula | C14H12FNO4 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-(1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(N2C(=O)C3CCCC3C2=O)c1 |
| InChI | InChI=1S/C14H12FNO4/c15-10-5-4-7(14(19)20)6-11(10)16-12(17)8-2-1-3-9(8)13(16)18/h4-6,8-9H,1-3H2,(H,19,20) |
| InChIKey | QGUUFUAPGWMRAL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|