C16H17BrN2 — CID 103980512
N-(3-bromophenyl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine (PubChem CID 103980512) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is N-(3-bromophenyl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine.
| Compound Name | N-(3-bromophenyl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 103980512 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(3-bromophenyl)-2,3,4,5-tetrahydro-1H-2-benzazepin-5-amine |
| SMILES | Brc1cccc(NC2CCNCc3ccccc32)c1 |
| InChI | InChI=1S/C16H17BrN2/c17-13-5-3-6-14(10-13)19-16-8-9-18-11-12-4-1-2-7-15(12)16/h1-7,10,16,18-19H,8-9,11H2 |
| InChIKey | ACOMUANDWCBWEO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |