About N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine
N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine (PubChem CID 103981038) has the molecular formula C13H18F3N3O
and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine.
Molecular Properties
| Compound Name | N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine |
| PubChem CID | 103981038 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine |
| SMILES | FC(F)(F)COc1ccc(NC2CCCNCC2)cn1 |
| InChI | InChI=1S/C13H18F3N3O/c14-13(15,16)9-20-12-4-3-11(8-18-12)19-10-2-1-6-17-7-5-10/h3-4,8,10,17,19H,1-2,5-7,9H2 |
| InChIKey | ALZCBYUMCDOFSC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine?
The IUPAC name of N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine (CID 103981038) is N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine.
What is the SMILES notation for N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine?
The canonical SMILES for N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine is FC(F)(F)COc1ccc(NC2CCCNCC2)cn1.
What is the InChIKey of N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine?
The InChIKey is ALZCBYUMCDOFSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N3O/c14-13(15,16)9-20-12-4-3-11(8-18-12)19-10-2-1-6-17-7-5-10/h3-4,8,10,17,19H,1-2,5-7,9H2.
What are the key properties of N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine?
N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine has a molecular weight of 289.30 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]azepan-4-amine is sourced from PubChem (CID 103981038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).