C16H26N2 — CID 103981634
N-[1-(2-methylphenyl)propan-2-yl]azepan-4-amine (PubChem CID 103981634) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[1-(2-methylphenyl)propan-2-yl]azepan-4-amine.
| Compound Name | N-[1-(2-methylphenyl)propan-2-yl]azepan-4-amine |
|---|---|
| PubChem CID | 103981634 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[1-(2-methylphenyl)propan-2-yl]azepan-4-amine |
| SMILES | Cc1ccccc1CC(C)NC1CCCNCC1 |
| InChI | InChI=1S/C16H26N2/c1-13-6-3-4-7-15(13)12-14(2)18-16-8-5-10-17-11-9-16/h3-4,6-7,14,16-18H,5,8-12H2,1-2H3 |
| InChIKey | JFFMOEULUXJJJN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |