C20H11Cl2NO2 — CID 1039817
6-(3,4-dichlorophenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 1039817) has the molecular formula C20H11Cl2NO2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-(3,4-dichlorophenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 1039817 |
| Molecular Formula | C20H11Cl2NO2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ccc(Cl)c(Cl)c1)CC3 |
| InChI | InChI=1S/C20H11Cl2NO2/c21-15-8-5-12(9-16(15)22)23-19(24)13-6-3-10-1-2-11-4-7-14(20(23)25)18(13)17(10)11/h3-9H,1-2H2 |
| InChIKey | ABQNKCNSRJTIQN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|