C13H28N4 — CID 103982170
N-[(1,4-dimethylpiperazin-2-yl)methyl]azepan-4-amine (PubChem CID 103982170) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]azepan-4-amine.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]azepan-4-amine |
|---|---|
| PubChem CID | 103982170 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]azepan-4-amine |
| SMILES | CN1CCN(C)C(CNC2CCCNCC2)C1 |
| InChI | InChI=1S/C13H28N4/c1-16-8-9-17(2)13(11-16)10-15-12-4-3-6-14-7-5-12/h12-15H,3-11H2,1-2H3 |
| InChIKey | XHXLTWUEMPHHNK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |