C19H36N2O2 — CID 103982271
tert-butyl 4-[(3,5-dimethylcyclohexyl)amino]azepane-1-carboxylate (PubChem CID 103982271) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is tert-butyl 4-[(3,5-dimethylcyclohexyl)amino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[(3,5-dimethylcyclohexyl)amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 103982271 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tert-butyl 4-[(3,5-dimethylcyclohexyl)amino]azepane-1-carboxylate |
| SMILES | CC1CC(C)CC(NC2CCCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C19H36N2O2/c1-14-11-15(2)13-17(12-14)20-16-7-6-9-21(10-8-16)18(22)23-19(3,4)5/h14-17,20H,6-13H2,1-5H3 |
| InChIKey | XLQNSHWQRXUQKT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |