About 4-prop-2-enylazepan-4-ol
4-prop-2-enylazepan-4-ol (PubChem CID 103982838) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 4-prop-2-enylazepan-4-ol.
Molecular Properties
| Compound Name | 4-prop-2-enylazepan-4-ol |
| PubChem CID | 103982838 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 4-prop-2-enylazepan-4-ol |
| SMILES | C=CCC1(O)CCCNCC1 |
| InChI | InChI=1S/C9H17NO/c1-2-4-9(11)5-3-7-10-8-6-9/h2,10-11H,1,3-8H2 |
| InChIKey | JUIURGGTOKIPKD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enylazepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enylazepan-4-ol?
The IUPAC name of 4-prop-2-enylazepan-4-ol (CID 103982838) is 4-prop-2-enylazepan-4-ol.
What is the SMILES notation for 4-prop-2-enylazepan-4-ol?
The canonical SMILES for 4-prop-2-enylazepan-4-ol is C=CCC1(O)CCCNCC1.
What is the InChIKey of 4-prop-2-enylazepan-4-ol?
The InChIKey is JUIURGGTOKIPKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-2-4-9(11)5-3-7-10-8-6-9/h2,10-11H,1,3-8H2.
What are the key properties of 4-prop-2-enylazepan-4-ol?
4-prop-2-enylazepan-4-ol has a molecular weight of 155.24 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enylazepan-4-ol is sourced from PubChem (CID 103982838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).