C16H21N3O2 — CID 103983515
3-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-5-yl)piperazine-2,6-dione (PubChem CID 103983515) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-5-yl)piperazine-2,6-dione.
| Compound Name | 3-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-5-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 103983515 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-5-yl)piperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C1CCNCc2ccccc21 |
| InChI | InChI=1S/C16H21N3O2/c1-2-13-16(21)18-15(20)10-19(13)14-7-8-17-9-11-5-3-4-6-12(11)14/h3-6,13-14,17H,2,7-10H2,1H3,(H,18,20,21) |
| InChIKey | UFLRHMROCMFPEV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|