C16H27NO — CID 103984387
N-tert-butyl-2-(methoxymethyl)-3-(2-methylphenyl)propan-1-amine (PubChem CID 103984387) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-tert-butyl-2-(methoxymethyl)-3-(2-methylphenyl)propan-1-amine.
| Compound Name | N-tert-butyl-2-(methoxymethyl)-3-(2-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 103984387 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-tert-butyl-2-(methoxymethyl)-3-(2-methylphenyl)propan-1-amine |
| SMILES | COCC(CNC(C)(C)C)Cc1ccccc1C |
| InChI | InChI=1S/C16H27NO/c1-13-8-6-7-9-15(13)10-14(12-18-5)11-17-16(2,3)4/h6-9,14,17H,10-12H2,1-5H3 |
| InChIKey | QQCWYXXGMCSBNN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |