C13H13Br2N3O2 — CID 103985859
2,4-dibromo-6-[3-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 103985859) has the molecular formula C13H13Br2N3O2 and a molecular weight of 403.07 g/mol. Its IUPAC name is 2,4-dibromo-6-[3-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2,4-dibromo-6-[3-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 103985859 |
| Molecular Formula | C13H13Br2N3O2 |
| Molecular Weight | 403.07 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | 2,4-dibromo-6-[3-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1c(Br)cc(Br)cc1-c1nc(CC2CCOC2)no1 |
| InChI | InChI=1S/C13H13Br2N3O2/c14-8-4-9(12(16)10(15)5-8)13-17-11(18-20-13)3-7-1-2-19-6-7/h4-5,7H,1-3,6,16H2 |
| InChIKey | HOWXYQVBGIFHDW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.07 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|