C14H10N2O — CID 10398627
3-[(E)-2-pyridin-4-ylethenyl]-1,2-benzoxazole (PubChem CID 10398627) has the molecular formula C14H10N2O and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-[(E)-2-pyridin-4-ylethenyl]-1,2-benzoxazole.
| Compound Name | 3-[(E)-2-pyridin-4-ylethenyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 10398627 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-[(E)-2-pyridin-4-ylethenyl]-1,2-benzoxazole |
| SMILES | C(=C/c1noc2ccccc12)\c1ccncc1 |
| InChI | InChI=1S/C14H10N2O/c1-2-4-14-12(3-1)13(16-17-14)6-5-11-7-9-15-10-8-11/h1-10H/b6-5+ |
| InChIKey | INOWWNGKAOMZCD-AATRIKPKSA-N |
| XLogP | 3.39 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |