C14H22O2 — CID 10398652
(1R,7S,8R)-7-methoxy-2,8-dimethyltricyclo[5.2.2.01,5]undec-5-en-8-ol (PubChem CID 10398652) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,7S,8R)-7-methoxy-2,8-dimethyltricyclo[5.2.2.01,5]undec-5-en-8-ol.
| Compound Name | (1R,7S,8R)-7-methoxy-2,8-dimethyltricyclo[5.2.2.01,5]undec-5-en-8-ol |
|---|---|
| PubChem CID | 10398652 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,7S,8R)-7-methoxy-2,8-dimethyltricyclo[5.2.2.01,5]undec-5-en-8-ol |
| SMILES | CO[C@]12C=C3CCC(C)[C@@]3(CC1)C[C@@]2(C)O |
| InChI | InChI=1S/C14H22O2/c1-10-4-5-11-8-14(16-3)7-6-13(10,11)9-12(14,2)15/h8,10,15H,4-7,9H2,1-3H3/t10?,12-,13-,14+/m1/s1 |
| InChIKey | YIXXTCJEFUESBT-KNEGCTHCSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|