C11H17NO2 — CID 103987114
1-(furan-3-yl)-N-methyl-2-(oxolan-3-yl)ethanamine (PubChem CID 103987114) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-(furan-3-yl)-N-methyl-2-(oxolan-3-yl)ethanamine.
| Compound Name | 1-(furan-3-yl)-N-methyl-2-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 103987114 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-(furan-3-yl)-N-methyl-2-(oxolan-3-yl)ethanamine |
| SMILES | CNC(CC1CCOC1)c1ccoc1 |
| InChI | InChI=1S/C11H17NO2/c1-12-11(10-3-5-14-8-10)6-9-2-4-13-7-9/h3,5,8-9,11-12H,2,4,6-7H2,1H3 |
| InChIKey | GCYUDLAYTVGFOQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |