C13H20BrN3O — CID 103987845
5-bromo-6-tert-butyl-2-(oxolan-3-ylmethyl)pyrimidin-4-amine (PubChem CID 103987845) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-(oxolan-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-6-tert-butyl-2-(oxolan-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103987845 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-(oxolan-3-ylmethyl)pyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(CC2CCOC2)nc(N)c1Br |
| InChI | InChI=1S/C13H20BrN3O/c1-13(2,3)11-10(14)12(15)17-9(16-11)6-8-4-5-18-7-8/h8H,4-7H2,1-3H3,(H2,15,16,17) |
| InChIKey | GMUDHXZIIINMOE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |