C12H13N5 — CID 10398835
(3Z)-4-amino-4-piperidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 10398835) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is (3Z)-4-amino-4-piperidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3Z)-4-amino-4-piperidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 10398835 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (3Z)-4-amino-4-piperidin-1-ylbuta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C/C(C#N)=C(\N)N1CCCCC1 |
| InChI | InChI=1S/C12H13N5/c13-7-10(8-14)6-11(9-15)12(16)17-4-2-1-3-5-17/h6H,1-5,16H2/b12-11- |
| InChIKey | VREQWCMJMMWOCL-QXMHVHEDSA-N |
| XLogP | 1.14 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|