C10H13NO3S — CID 10398836
4-methyl-N-[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide (PubChem CID 10398836) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-methyl-N-[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10398836 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-methyl-N-[[(2R)-oxiran-2-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@H]2CO2)cc1 |
| InChI | InChI=1S/C10H13NO3S/c1-8-2-4-10(5-3-8)15(12,13)11-6-9-7-14-9/h2-5,9,11H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | JYNOTASVIQWSJV-SECBINFHSA-N |
| XLogP | 0.67 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|