About 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile
3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile (PubChem CID 103989389) has the molecular formula C13H14ClN3O3S
and a molecular weight of 327.79 g/mol. Its IUPAC name is 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile |
| PubChem CID | 103989389 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile |
| SMILES | CC1(C)C(=O)NCCN1S(=O)(=O)c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C13H14ClN3O3S/c1-13(2)12(18)16-5-6-17(13)21(19,20)11-4-3-9(8-15)7-10(11)14/h3-4,7H,5-6H2,1-2H3,(H,16,18) |
| InChIKey | AWUCIQKOHPURSD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile?
The IUPAC name of 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile (CID 103989389) is 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile.
What is the SMILES notation for 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile?
The canonical SMILES for 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile is CC1(C)C(=O)NCCN1S(=O)(=O)c1ccc(C#N)cc1Cl.
What is the InChIKey of 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile?
The InChIKey is AWUCIQKOHPURSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN3O3S/c1-13(2)12(18)16-5-6-17(13)21(19,20)11-4-3-9(8-15)7-10(11)14/h3-4,7H,5-6H2,1-2H3,(H,16,18).
What are the key properties of 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile?
3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile has a molecular weight of 327.79 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylbenzonitrile is sourced from PubChem (CID 103989389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).