About (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol
(E)-4-deuterio-1,1-diethoxynon-2-en-4-ol (PubChem CID 10399020) has the molecular formula C13H26O3
and a molecular weight of 231.35 g/mol. Its IUPAC name is (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol.
Molecular Properties
| Compound Name | (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol |
| PubChem CID | 10399020 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol |
| SMILES | [2H]C(O)(/C=C/C(OCC)OCC)CCCCC |
| InChI | InChI=1S/C13H26O3/c1-4-7-8-9-12(14)10-11-13(15-5-2)16-6-3/h10-14H,4-9H2,1-3H3/b11-10+/i12D |
| InChIKey | MHUXURLVOJXADV-YQODLGQGSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol?
The IUPAC name of (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol (CID 10399020) is (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol.
What is the SMILES notation for (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol?
The canonical SMILES for (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol is [2H]C(O)(/C=C/C(OCC)OCC)CCCCC.
What is the InChIKey of (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol?
The InChIKey is MHUXURLVOJXADV-YQODLGQGSA-N. The full InChI is InChI=1S/C13H26O3/c1-4-7-8-9-12(14)10-11-13(15-5-2)16-6-3/h10-14H,4-9H2,1-3H3/b11-10+/i12D.
What are the key properties of (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol?
(E)-4-deuterio-1,1-diethoxynon-2-en-4-ol has a molecular weight of 231.35 g/mol, XLogP of 2.88, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-deuterio-1,1-diethoxynon-2-en-4-ol is sourced from PubChem (CID 10399020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).