C13H13ClN2 — CID 10399068
6-chloro-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 10399068) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 6-chloro-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 6-chloro-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 10399068 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 6-chloro-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Nc1c2c(nc3cc(Cl)ccc13)CCCC2 |
| InChI | InChI=1S/C13H13ClN2/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15/h5-7H,1-4H2,(H2,15,16) |
| InChIKey | GQZMDBQRGRRPMS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |