About N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide
N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide (PubChem CID 10399116) has the molecular formula C12H14N2O3
and a molecular weight of 234.25 g/mol. Its IUPAC name is N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide |
| PubChem CID | 10399116 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1O)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C12H14N2O3/c1-6(15)13-8-5-4-7-9(10(8)16)12(2,3)11(17)14-7/h4-5,16H,1-3H3,(H,13,15)(H,14,17) |
| InChIKey | UXOQACHPQNKIGE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide?
The IUPAC name of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide (CID 10399116) is N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide.
What is the SMILES notation for N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide?
The canonical SMILES for N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide is CC(=O)Nc1ccc2c(c1O)C(C)(C)C(=O)N2.
What is the InChIKey of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide?
The InChIKey is UXOQACHPQNKIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-6(15)13-8-5-4-7-9(10(8)16)12(2,3)11(17)14-7/h4-5,16H,1-3H3,(H,13,15)(H,14,17).
What are the key properties of N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide?
N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide has a molecular weight of 234.25 g/mol, XLogP of 1.58, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)acetamide is sourced from PubChem (CID 10399116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).