C13H16FNO2 — CID 10399263
2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide (PubChem CID 10399263) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide.
| Compound Name | 2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide |
|---|---|
| PubChem CID | 10399263 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-fluoro-4,4-dimethyl-3-oxo-N-phenylpentanamide |
| SMILES | CC(C)(C)C(=O)C(F)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H16FNO2/c1-13(2,3)11(16)10(14)12(17)15-9-7-5-4-6-8-9/h4-8,10H,1-3H3,(H,15,17) |
| InChIKey | BYTBZXKEEXTXID-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|