About 3',5'-Dihydroxyacetophenone
3',5'-Dihydroxyacetophenone (PubChem CID 103993) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 1-(3,5-dihydroxyphenyl)ethanone.
Molecular Properties
| Compound Name | 3',5'-Dihydroxyacetophenone |
| PubChem CID | 103993 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 1-(3,5-dihydroxyphenyl)ethanone |
| SMILES | CC(=O)C1=CC(=CC(=C1)O)O |
| InChI | InChI=1S/C8H8O3/c1-5(9)6-2-7(10)4-8(11)3-6/h2-4,10-11H,1H3 |
| InChIKey | WQXWIKCZNIGMAP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 145 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3',5'-Dihydroxyacetophenone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3',5'-Dihydroxyacetophenone?
The IUPAC name of 3',5'-Dihydroxyacetophenone (CID 103993) is 1-(3,5-dihydroxyphenyl)ethanone.
What is the SMILES notation for 3',5'-Dihydroxyacetophenone?
The canonical SMILES for 3',5'-Dihydroxyacetophenone is CC(=O)C1=CC(=CC(=C1)O)O.
What is the InChIKey of 3',5'-Dihydroxyacetophenone?
The InChIKey is WQXWIKCZNIGMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-5(9)6-2-7(10)4-8(11)3-6/h2-4,10-11H,1H3.
What are the key properties of 3',5'-Dihydroxyacetophenone?
3',5'-Dihydroxyacetophenone has a molecular weight of 152.15 g/mol, XLogP of 0.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3',5'-Dihydroxyacetophenone is sourced from PubChem (CID 103993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).