About 1-methyl-2,3-diphenylimidazolidine
1-methyl-2,3-diphenylimidazolidine (PubChem CID 10399319) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-methyl-2,3-diphenylimidazolidine.
Molecular Properties
| Compound Name | 1-methyl-2,3-diphenylimidazolidine |
| PubChem CID | 10399319 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-methyl-2,3-diphenylimidazolidine |
| SMILES | CN1CCN(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C16H18N2/c1-17-12-13-18(15-10-6-3-7-11-15)16(17)14-8-4-2-5-9-14/h2-11,16H,12-13H2,1H3 |
| InChIKey | PHVZEWGFVRMOPG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-2,3-diphenylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-diphenylimidazolidine?
The IUPAC name of 1-methyl-2,3-diphenylimidazolidine (CID 10399319) is 1-methyl-2,3-diphenylimidazolidine.
What is the SMILES notation for 1-methyl-2,3-diphenylimidazolidine?
The canonical SMILES for 1-methyl-2,3-diphenylimidazolidine is CN1CCN(c2ccccc2)C1c1ccccc1.
What is the InChIKey of 1-methyl-2,3-diphenylimidazolidine?
The InChIKey is PHVZEWGFVRMOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2/c1-17-12-13-18(15-10-6-3-7-11-15)16(17)14-8-4-2-5-9-14/h2-11,16H,12-13H2,1H3.
What are the key properties of 1-methyl-2,3-diphenylimidazolidine?
1-methyl-2,3-diphenylimidazolidine has a molecular weight of 238.33 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-diphenylimidazolidine is sourced from PubChem (CID 10399319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).