About methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate
methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate (PubChem CID 10399321) has the molecular formula C9H10N4S2
and a molecular weight of 238.34 g/mol. Its IUPAC name is methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate |
| PubChem CID | 10399321 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate |
| SMILES | CS/C(N)=N\c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C9H10N4S2/c1-14-8(10)12-5-2-3-6-7(4-5)15-9(11)13-6/h2-4H,1H3,(H2,10,12)(H2,11,13) |
| InChIKey | KYVUHPYGJCVJTF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate?
The IUPAC name of methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate (CID 10399321) is methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate.
What is the SMILES notation for methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate?
The canonical SMILES for methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate is CS/C(N)=N\c1ccc2nc(N)sc2c1.
What is the InChIKey of methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate?
The InChIKey is KYVUHPYGJCVJTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S2/c1-14-8(10)12-5-2-3-6-7(4-5)15-9(11)13-6/h2-4H,1H3,(H2,10,12)(H2,11,13).
What are the key properties of methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate?
methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate has a molecular weight of 238.34 g/mol, XLogP of 2.19, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-(2-amino-1,3-benzothiazol-6-yl)carbamimidothioate is sourced from PubChem (CID 10399321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).