C13H21N3O4 — CID 103994352
2-[2-(cyclopropanecarbonylamino)ethylcarbamoyl-(cyclopropylmethyl)amino]acetic acid (PubChem CID 103994352) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[2-(cyclopropanecarbonylamino)ethylcarbamoyl-(cyclopropylmethyl)amino]acetic acid.
| Compound Name | 2-[2-(cyclopropanecarbonylamino)ethylcarbamoyl-(cyclopropylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 103994352 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[2-(cyclopropanecarbonylamino)ethylcarbamoyl-(cyclopropylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C(=O)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C13H21N3O4/c17-11(18)8-16(7-9-1-2-9)13(20)15-6-5-14-12(19)10-3-4-10/h9-10H,1-8H2,(H,14,19)(H,15,20)(H,17,18) |
| InChIKey | CVBUSTNHHSRILC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|