C15H14O3 — CID 10399475
(2E,4E,6E)-1-(oxiran-2-yl)-7-phenoxyhepta-2,4,6-trien-1-one (PubChem CID 10399475) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2E,4E,6E)-1-(oxiran-2-yl)-7-phenoxyhepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6E)-1-(oxiran-2-yl)-7-phenoxyhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 10399475 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2E,4E,6E)-1-(oxiran-2-yl)-7-phenoxyhepta-2,4,6-trien-1-one |
| SMILES | O=C(/C=C/C=C/C=C/Oc1ccccc1)C1CO1 |
| InChI | InChI=1S/C15H14O3/c16-14(15-12-18-15)10-6-1-2-7-11-17-13-8-4-3-5-9-13/h1-11,15H,12H2/b2-1+,10-6+,11-7+ |
| InChIKey | YUOBARHYRGMUJB-ASCCJCISSA-N |
| XLogP | 2.66 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|