C13H13ClFN — CID 103996076
4-chloro-3-ethyl-7-fluoro-2,6-dimethylquinoline (PubChem CID 103996076) has the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. Its IUPAC name is 4-chloro-3-ethyl-7-fluoro-2,6-dimethylquinoline.
| Compound Name | 4-chloro-3-ethyl-7-fluoro-2,6-dimethylquinoline |
|---|---|
| PubChem CID | 103996076 |
| Molecular Formula | C13H13ClFN |
| Molecular Weight | 237.70 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-chloro-3-ethyl-7-fluoro-2,6-dimethylquinoline |
| SMILES | CCc1c(C)nc2cc(F)c(C)cc2c1Cl |
| InChI | InChI=1S/C13H13ClFN/c1-4-9-8(3)16-12-6-11(15)7(2)5-10(12)13(9)14/h5-6H,4H2,1-3H3 |
| InChIKey | FFPSKYATFKGEEB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |