About 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine
9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine (PubChem CID 103996089) has the molecular formula C14H13ClFN
and a molecular weight of 249.72 g/mol. Its IUPAC name is 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine.
Molecular Properties
| Compound Name | 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine |
| PubChem CID | 103996089 |
| Molecular Formula | C14H13ClFN |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine |
| SMILES | Cc1cc2c(Cl)c3c(nc2cc1F)CCCC3 |
| InChI | InChI=1S/C14H13ClFN/c1-8-6-10-13(7-11(8)16)17-12-5-3-2-4-9(12)14(10)15/h6-7H,2-5H2,1H3 |
| InChIKey | TZVNNACIWLCSQS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine?
The IUPAC name of 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine (CID 103996089) is 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine.
What is the SMILES notation for 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine?
The canonical SMILES for 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine is Cc1cc2c(Cl)c3c(nc2cc1F)CCCC3.
What is the InChIKey of 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine?
The InChIKey is TZVNNACIWLCSQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClFN/c1-8-6-10-13(7-11(8)16)17-12-5-3-2-4-9(12)14(10)15/h6-7H,2-5H2,1H3.
What are the key properties of 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine?
9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine has a molecular weight of 249.72 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-6-fluoro-7-methyl-1,2,3,4-tetrahydroacridine is sourced from PubChem (CID 103996089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).