C17H15FN2 — CID 103996202
7-fluoro-N,6-dimethyl-2-phenylquinolin-4-amine (PubChem CID 103996202) has the molecular formula C17H15FN2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 7-fluoro-N,6-dimethyl-2-phenylquinolin-4-amine.
| Compound Name | 7-fluoro-N,6-dimethyl-2-phenylquinolin-4-amine |
|---|---|
| PubChem CID | 103996202 |
| Molecular Formula | C17H15FN2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 7-fluoro-N,6-dimethyl-2-phenylquinolin-4-amine |
| SMILES | CNc1cc(-c2ccccc2)nc2cc(F)c(C)cc12 |
| InChI | InChI=1S/C17H15FN2/c1-11-8-13-16(19-2)10-15(12-6-4-3-5-7-12)20-17(13)9-14(11)18/h3-10H,1-2H3,(H,19,20) |
| InChIKey | LFRJPBKGCLGFJK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |