C10H15NO2S2 — CID 10399636
2-methylsulfanyl-5-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1,3-thiazole (PubChem CID 10399636) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-methylsulfanyl-5-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1,3-thiazole.
| Compound Name | 2-methylsulfanyl-5-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 10399636 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-methylsulfanyl-5-[(4R)-2,2,4-trimethyl-1,3-dioxolan-4-yl]-1,3-thiazole |
| SMILES | CSc1ncc([C@@]2(C)COC(C)(C)O2)s1 |
| InChI | InChI=1S/C10H15NO2S2/c1-9(2)12-6-10(3,13-9)7-5-11-8(14-4)15-7/h5H,6H2,1-4H3/t10-/m1/s1 |
| InChIKey | VSCNICKLBCYEQW-SNVBAGLBSA-N |
| XLogP | 2.86 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|