C9H13BrO3 — CID 10399792
[(1S,2S,4R,5R)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] (2S)-2-bromopropanoate (PubChem CID 10399792) has the molecular formula C9H13BrO3 and a molecular weight of 249.10 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] (2S)-2-bromopropanoate.
| Compound Name | [(1S,2S,4R,5R)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] (2S)-2-bromopropanoate |
|---|---|
| PubChem CID | 10399792 |
| Molecular Formula | C9H13BrO3 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | [(1S,2S,4R,5R)-4-hydroxy-2-bicyclo[3.1.0]hexanyl] (2S)-2-bromopropanoate |
| SMILES | C[C@H](Br)C(=O)O[C@H]1C[C@@H](O)[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C9H13BrO3/c1-4(10)9(12)13-8-3-7(11)5-2-6(5)8/h4-8,11H,2-3H2,1H3/t4-,5+,6-,7+,8-/m0/s1 |
| InChIKey | VHKZYEFFDORTCC-YMVPXFTJSA-N |
| XLogP | 1.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|