C13H14O5 — CID 10399840
(2R,3S,3aR,6aR)-3-hydroxy-2-[(S)-hydroxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 10399840) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2R,3S,3aR,6aR)-3-hydroxy-2-[(S)-hydroxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3S,3aR,6aR)-3-hydroxy-2-[(S)-hydroxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 10399840 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2R,3S,3aR,6aR)-3-hydroxy-2-[(S)-hydroxy(phenyl)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | O=C1C[C@H]2O[C@H]([C@@H](O)c3ccccc3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C13H14O5/c14-9-6-8-12(18-9)11(16)13(17-8)10(15)7-4-2-1-3-5-7/h1-5,8,10-13,15-16H,6H2/t8-,10+,11-,12+,13-/m1/s1 |
| InChIKey | OGSSCWFZICJOMO-YBPUZQHNSA-N |
| XLogP | 0.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |