C22H16IN3O — CID 1039986
(1R,2S,3aR)-1-acetyl-2-(2-iodophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile (PubChem CID 1039986) has the molecular formula C22H16IN3O and a molecular weight of 465.29 g/mol. Its IUPAC name is (1R,2S,3aR)-1-acetyl-2-(2-iodophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile.
| Compound Name | (1R,2S,3aR)-1-acetyl-2-(2-iodophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 1039986 |
| Molecular Formula | C22H16IN3O |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | (1R,2S,3aR)-1-acetyl-2-(2-iodophenyl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,3-dicarbonitrile |
| SMILES | CC(=O)[C@H]1[C@H](c2ccccc2I)C(C#N)(C#N)[C@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C22H16IN3O/c1-14(27)21-20(16-7-3-4-8-17(16)23)22(12-24,13-25)19-11-10-15-6-2-5-9-18(15)26(19)21/h2-11,19-21H,1H3/t19-,20+,21+/m1/s1 |
| InChIKey | XYKXLHPMZWXPPW-HKBOAZHASA-N |
| XLogP | 4.28 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|