C17H25N3O — CID 103998667
N-[2-(azepan-1-yl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide (PubChem CID 103998667) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 103998667 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-2,3-dihydro-1H-isoindole-5-carboxamide |
| SMILES | O=C(NCCN1CCCCCC1)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C17H25N3O/c21-17(14-5-6-15-12-18-13-16(15)11-14)19-7-10-20-8-3-1-2-4-9-20/h5-6,11,18H,1-4,7-10,12-13H2,(H,19,21) |
| InChIKey | BGGAQMGAJRUYBK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |